C13H17N5 — CID 78990149
6-N-ethyl-2-N-(2-pyridin-3-ylethyl)pyrazine-2,6-diamine (PubChem CID 78990149) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 6-N-ethyl-2-N-(2-pyridin-3-ylethyl)pyrazine-2,6-diamine.
| Compound Name | 6-N-ethyl-2-N-(2-pyridin-3-ylethyl)pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 78990149 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 6-N-ethyl-2-N-(2-pyridin-3-ylethyl)pyrazine-2,6-diamine |
| SMILES | CCNc1cncc(NCCc2cccnc2)n1 |
| InChI | InChI=1S/C13H17N5/c1-2-16-12-9-15-10-13(18-12)17-7-5-11-4-3-6-14-8-11/h3-4,6,8-10H,2,5,7H2,1H3,(H2,16,17,18) |
| InChIKey | HDYJKNNACGCXKG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |