C13H15N3O — CID 106503992
5-methoxy-N-(2-pyridin-3-ylethyl)pyridin-2-amine (PubChem CID 106503992) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 5-methoxy-N-(2-pyridin-3-ylethyl)pyridin-2-amine.
| Compound Name | 5-methoxy-N-(2-pyridin-3-ylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106503992 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 5-methoxy-N-(2-pyridin-3-ylethyl)pyridin-2-amine |
| SMILES | COc1ccc(NCCc2cccnc2)nc1 |
| InChI | InChI=1S/C13H15N3O/c1-17-12-4-5-13(16-10-12)15-8-6-11-3-2-7-14-9-11/h2-5,7,9-10H,6,8H2,1H3,(H,15,16) |
| InChIKey | ORKKLPFDTHDIBT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |