C14H15FN2O — CID 61311581
5-fluoro-N-[2-(4-methoxyphenyl)ethyl]pyridin-2-amine (PubChem CID 61311581) has the molecular formula C14H15FN2O and a molecular weight of 246.29 g/mol. Its IUPAC name is 5-fluoro-N-[2-(4-methoxyphenyl)ethyl]pyridin-2-amine.
| Compound Name | 5-fluoro-N-[2-(4-methoxyphenyl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 61311581 |
| Molecular Formula | C14H15FN2O |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 5-fluoro-N-[2-(4-methoxyphenyl)ethyl]pyridin-2-amine |
| SMILES | COc1ccc(CCNc2ccc(F)cn2)cc1 |
| InChI | InChI=1S/C14H15FN2O/c1-18-13-5-2-11(3-6-13)8-9-16-14-7-4-12(15)10-17-14/h2-7,10H,8-9H2,1H3,(H,16,17) |
| InChIKey | JHBYLSORFFWYJF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |