C11H10Cl2N4 — CID 59258790
2,6-dichloro-N-(2-pyridin-3-ylethyl)pyrimidin-4-amine (PubChem CID 59258790) has the molecular formula C11H10Cl2N4 and a molecular weight of 269.14 g/mol. Its IUPAC name is 2,6-dichloro-N-(2-pyridin-3-ylethyl)pyrimidin-4-amine.
| Compound Name | 2,6-dichloro-N-(2-pyridin-3-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 59258790 |
| Molecular Formula | C11H10Cl2N4 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2,6-dichloro-N-(2-pyridin-3-ylethyl)pyrimidin-4-amine |
| SMILES | Clc1cc(NCCc2cccnc2)nc(Cl)n1 |
| InChI | InChI=1S/C11H10Cl2N4/c12-9-6-10(17-11(13)16-9)15-5-3-8-2-1-4-14-7-8/h1-2,4,6-7H,3,5H2,(H,15,16,17) |
| InChIKey | OVIQPQYZDJZHHT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |