C11H16N4O3 — CID 66457291
methyl 6-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]pyrazine-2-carboxylate (PubChem CID 66457291) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 6-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66457291 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | methyl 6-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NCC(=O)NC(C)C)n1 |
| InChI | InChI=1S/C11H16N4O3/c1-7(2)14-10(16)6-13-9-5-12-4-8(15-9)11(17)18-3/h4-5,7H,6H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | YAVTWJCTWHIONG-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |