methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate

C10H10N4O2S — CID 104577442

IUPACmethyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate
SMILESCOC(=O)c1cncc(NCc2cncs2)n1
InChIInChI=1S/C10H10N4O2S/c1-16-10(15)8-4-11-5-9(14-8)13-3-7-2-12-6-17-7/h2,4-6H,3H2,1H3,(H,13,14)
InChIKeyMOLHBNSUDRCCBQ-UHFFFAOYSA-N
MW250.28 g/mol
LogP1.33
Rot. Bonds4

About methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate

methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate (PubChem CID 104577442) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate.

Molecular Properties

Compound Namemethyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate
PubChem CID104577442
Molecular FormulaC10H10N4O2S
Molecular Weight250.28 g/mol
Exact Mass250.05
IUPAC Namemethyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate
SMILESCOC(=O)c1cncc(NCc2cncs2)n1
InChIInChI=1S/C10H10N4O2S/c1-16-10(15)8-4-11-5-9(14-8)13-3-7-2-12-6-17-7/h2,4-6H,3H2,1H3,(H,13,14)
InChIKeyMOLHBNSUDRCCBQ-UHFFFAOYSA-N
XLogP1.33
TPSA77.00 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.28
LogP ≤ 51.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate?
The IUPAC name of methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate (CID 104577442) is methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate.
What is the SMILES notation for methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate?
The canonical SMILES for methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate is COC(=O)c1cncc(NCc2cncs2)n1.
What is the InChIKey of methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate?
The InChIKey is MOLHBNSUDRCCBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2S/c1-16-10(15)8-4-11-5-9(14-8)13-3-7-2-12-6-17-7/h2,4-6H,3H2,1H3,(H,13,14).
What are the key properties of methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate?
methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate has a molecular weight of 250.28 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate is sourced from PubChem (CID 104577442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).