C10H10N4O2S — CID 104577442
methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate (PubChem CID 104577442) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate.
| Compound Name | methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 104577442 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | methyl 6-(1,3-thiazol-5-ylmethylamino)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NCc2cncs2)n1 |
| InChI | InChI=1S/C10H10N4O2S/c1-16-10(15)8-4-11-5-9(14-8)13-3-7-2-12-6-17-7/h2,4-6H,3H2,1H3,(H,13,14) |
| InChIKey | MOLHBNSUDRCCBQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |