C11H15N3O3S — CID 114233017
methyl 6-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylpyrazine-2-carboxylate (PubChem CID 114233017) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is methyl 6-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylpyrazine-2-carboxylate.
| Compound Name | methyl 6-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 114233017 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | methyl 6-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylpyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(SCC(=O)NC(C)C)n1 |
| InChI | InChI=1S/C11H15N3O3S/c1-7(2)13-9(15)6-18-10-5-12-4-8(14-10)11(16)17-3/h4-5,7H,6H2,1-3H3,(H,13,15) |
| InChIKey | MFLIGRUVMITTME-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |