C7H10N4O3 — CID 112617333
methyl 2-oxo-2-[2-(1H-1,2,4-triazol-5-yl)ethylamino]acetate (PubChem CID 112617333) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is methyl 2-oxo-2-[2-(1H-1,2,4-triazol-5-yl)ethylamino]acetate.
| Compound Name | methyl 2-oxo-2-[2-(1H-1,2,4-triazol-5-yl)ethylamino]acetate |
|---|---|
| PubChem CID | 112617333 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | methyl 2-oxo-2-[2-(1H-1,2,4-triazol-5-yl)ethylamino]acetate |
| SMILES | COC(=O)C(=O)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C7H10N4O3/c1-14-7(13)6(12)8-3-2-5-9-4-10-11-5/h4H,2-3H2,1H3,(H,8,12)(H,9,10,11) |
| InChIKey | WKNZPZMKUUHYPJ-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|