C8H15N5O — CID 79023094
(2S)-2-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide (PubChem CID 79023094) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide.
| Compound Name | (2S)-2-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 79023094 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | (2S)-2-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanamide |
| SMILES | CC[C@H](N)C(=O)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C8H15N5O/c1-2-6(9)8(14)10-4-3-7-11-5-12-13-7/h5-6H,2-4,9H2,1H3,(H,10,14)(H,11,12,13)/t6-/m0/s1 |
| InChIKey | REOURYPPTPIQBF-LURJTMIESA-N |
| XLogP | -0.80 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |