About 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate
2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate (PubChem CID 166304182) has the molecular formula C15H19NO5
and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate.
Molecular Properties
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate |
| PubChem CID | 166304182 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate |
| SMILES | N#Cc1cccc(CC(=O)OCCOCCOCCO)c1 |
| InChI | InChI=1S/C15H19NO5/c16-12-14-3-1-2-13(10-14)11-15(18)21-9-8-20-7-6-19-5-4-17/h1-3,10,17H,4-9,11H2 |
| InChIKey | LVAMNNWMDNVCJI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate?
The IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate (CID 166304182) is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate.
What is the SMILES notation for 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate?
The canonical SMILES for 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate is N#Cc1cccc(CC(=O)OCCOCCOCCO)c1.
What is the InChIKey of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate?
The InChIKey is LVAMNNWMDNVCJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO5/c16-12-14-3-1-2-13(10-14)11-15(18)21-9-8-20-7-6-19-5-4-17/h1-3,10,17H,4-9,11H2.
What are the key properties of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate?
2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate has a molecular weight of 293.32 g/mol, XLogP of 0.67, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-(3-cyanophenyl)acetate is sourced from PubChem (CID 166304182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).