C13H15NO2S — CID 82177663
propyl 2-[(3-cyanophenyl)methylsulfanyl]acetate (PubChem CID 82177663) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is propyl 2-[(3-cyanophenyl)methylsulfanyl]acetate.
| Compound Name | propyl 2-[(3-cyanophenyl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 82177663 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | propyl 2-[(3-cyanophenyl)methylsulfanyl]acetate |
| SMILES | CCCOC(=O)CSCc1cccc(C#N)c1 |
| InChI | InChI=1S/C13H15NO2S/c1-2-6-16-13(15)10-17-9-12-5-3-4-11(7-12)8-14/h3-5,7H,2,6,9-10H2,1H3 |
| InChIKey | ZYJUSUSOVPGXPH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |