C13H14N2O3S — CID 107774427
(2R)-2-acetamido-3-[(3-cyanophenyl)methylsulfanyl]propanoic acid (PubChem CID 107774427) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(3-cyanophenyl)methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(3-cyanophenyl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 107774427 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (2R)-2-acetamido-3-[(3-cyanophenyl)methylsulfanyl]propanoic acid |
| SMILES | CC(=O)N[C@@H](CSCc1cccc(C#N)c1)C(=O)O |
| InChI | InChI=1S/C13H14N2O3S/c1-9(16)15-12(13(17)18)8-19-7-11-4-2-3-10(5-11)6-14/h2-5,12H,7-8H2,1H3,(H,15,16)(H,17,18)/t12-/m0/s1 |
| InChIKey | WKBCPZKGOBRCAX-LBPRGKRZSA-N |
| XLogP | 1.38 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |