C18H17NO4 — CID 7766167
(3-cyanophenyl)methyl 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 7766167) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (3-cyanophenyl)methyl 2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | (3-cyanophenyl)methyl 2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 7766167 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (3-cyanophenyl)methyl 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCc2cccc(C#N)c2)cc1OC |
| InChI | InChI=1S/C18H17NO4/c1-21-16-7-6-13(9-17(16)22-2)10-18(20)23-12-15-5-3-4-14(8-15)11-19/h3-9H,10,12H2,1-2H3 |
| InChIKey | GSYGSSZYBOXRKM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |