C20H21NO5 — CID 7776289
(3-cyanophenyl)methyl 3-(3,4,5-trimethoxyphenyl)propanoate (PubChem CID 7776289) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is (3-cyanophenyl)methyl 3-(3,4,5-trimethoxyphenyl)propanoate.
| Compound Name | (3-cyanophenyl)methyl 3-(3,4,5-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 7776289 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (3-cyanophenyl)methyl 3-(3,4,5-trimethoxyphenyl)propanoate |
| SMILES | COc1cc(CCC(=O)OCc2cccc(C#N)c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H21NO5/c1-23-17-10-14(11-18(24-2)20(17)25-3)7-8-19(22)26-13-16-6-4-5-15(9-16)12-21/h4-6,9-11H,7-8,13H2,1-3H3 |
| InChIKey | ACRGIFIWERPNIL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |