About 5-hydroxypentyl 2-(3-aminophenyl)acetate
5-hydroxypentyl 2-(3-aminophenyl)acetate (PubChem CID 62500174) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is 5-hydroxypentyl 2-(3-aminophenyl)acetate.
Molecular Properties
| Compound Name | 5-hydroxypentyl 2-(3-aminophenyl)acetate |
| PubChem CID | 62500174 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 5-hydroxypentyl 2-(3-aminophenyl)acetate |
| SMILES | Nc1cccc(CC(=O)OCCCCCO)c1 |
| InChI | InChI=1S/C13H19NO3/c14-12-6-4-5-11(9-12)10-13(16)17-8-3-1-2-7-15/h4-6,9,15H,1-3,7-8,10,14H2 |
| InChIKey | BSVDZVCQZQSVQL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxypentyl 2-(3-aminophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxypentyl 2-(3-aminophenyl)acetate?
The IUPAC name of 5-hydroxypentyl 2-(3-aminophenyl)acetate (CID 62500174) is 5-hydroxypentyl 2-(3-aminophenyl)acetate.
What is the SMILES notation for 5-hydroxypentyl 2-(3-aminophenyl)acetate?
The canonical SMILES for 5-hydroxypentyl 2-(3-aminophenyl)acetate is Nc1cccc(CC(=O)OCCCCCO)c1.
What is the InChIKey of 5-hydroxypentyl 2-(3-aminophenyl)acetate?
The InChIKey is BSVDZVCQZQSVQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c14-12-6-4-5-11(9-12)10-13(16)17-8-3-1-2-7-15/h4-6,9,15H,1-3,7-8,10,14H2.
What are the key properties of 5-hydroxypentyl 2-(3-aminophenyl)acetate?
5-hydroxypentyl 2-(3-aminophenyl)acetate has a molecular weight of 237.30 g/mol, XLogP of 1.52, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxypentyl 2-(3-aminophenyl)acetate is sourced from PubChem (CID 62500174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).