About phenylmethoxymethyl 2-(3-aminophenyl)acetate
phenylmethoxymethyl 2-(3-aminophenyl)acetate (PubChem CID 102940348) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is phenylmethoxymethyl 2-(3-aminophenyl)acetate.
Molecular Properties
| Compound Name | phenylmethoxymethyl 2-(3-aminophenyl)acetate |
| PubChem CID | 102940348 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | phenylmethoxymethyl 2-(3-aminophenyl)acetate |
| SMILES | Nc1cccc(CC(=O)OCOCc2ccccc2)c1 |
| InChI | InChI=1S/C16H17NO3/c17-15-8-4-7-14(9-15)10-16(18)20-12-19-11-13-5-2-1-3-6-13/h1-9H,10-12,17H2 |
| InChIKey | ZIJHRGFCTITAQC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze phenylmethoxymethyl 2-(3-aminophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethoxymethyl 2-(3-aminophenyl)acetate?
The IUPAC name of phenylmethoxymethyl 2-(3-aminophenyl)acetate (CID 102940348) is phenylmethoxymethyl 2-(3-aminophenyl)acetate.
What is the SMILES notation for phenylmethoxymethyl 2-(3-aminophenyl)acetate?
The canonical SMILES for phenylmethoxymethyl 2-(3-aminophenyl)acetate is Nc1cccc(CC(=O)OCOCc2ccccc2)c1.
What is the InChIKey of phenylmethoxymethyl 2-(3-aminophenyl)acetate?
The InChIKey is ZIJHRGFCTITAQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3/c17-15-8-4-7-14(9-15)10-16(18)20-12-19-11-13-5-2-1-3-6-13/h1-9H,10-12,17H2.
What are the key properties of phenylmethoxymethyl 2-(3-aminophenyl)acetate?
phenylmethoxymethyl 2-(3-aminophenyl)acetate has a molecular weight of 271.32 g/mol, XLogP of 2.53, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethoxymethyl 2-(3-aminophenyl)acetate is sourced from PubChem (CID 102940348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).