About 3-(chloromethyl)aniline;methyl 2-phenylacetate
3-(chloromethyl)aniline;methyl 2-phenylacetate (PubChem CID 18329589) has the molecular formula C16H18ClNO2
and a molecular weight of 291.78 g/mol. Its IUPAC name is 3-(chloromethyl)aniline;methyl 2-phenylacetate.
Molecular Properties
| Compound Name | 3-(chloromethyl)aniline;methyl 2-phenylacetate |
| PubChem CID | 18329589 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-(chloromethyl)aniline;methyl 2-phenylacetate |
| SMILES | COC(=O)Cc1ccccc1.Nc1cccc(CCl)c1 |
| InChI | InChI=1S/C9H10O2.C7H8ClN/c1-11-9(10)7-8-5-3-2-4-6-8;8-5-6-2-1-3-7(9)4-6/h2-6H,7H2,1H3;1-4H,5,9H2 |
| InChIKey | UEJWLITUZWSDKM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)aniline;methyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)aniline;methyl 2-phenylacetate?
The IUPAC name of 3-(chloromethyl)aniline;methyl 2-phenylacetate (CID 18329589) is 3-(chloromethyl)aniline;methyl 2-phenylacetate.
What is the SMILES notation for 3-(chloromethyl)aniline;methyl 2-phenylacetate?
The canonical SMILES for 3-(chloromethyl)aniline;methyl 2-phenylacetate is COC(=O)Cc1ccccc1.Nc1cccc(CCl)c1.
What is the InChIKey of 3-(chloromethyl)aniline;methyl 2-phenylacetate?
The InChIKey is UEJWLITUZWSDKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.C7H8ClN/c1-11-9(10)7-8-5-3-2-4-6-8;8-5-6-2-1-3-7(9)4-6/h2-6H,7H2,1H3;1-4H,5,9H2.
What are the key properties of 3-(chloromethyl)aniline;methyl 2-phenylacetate?
3-(chloromethyl)aniline;methyl 2-phenylacetate has a molecular weight of 291.78 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)aniline;methyl 2-phenylacetate is sourced from PubChem (CID 18329589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).