C19H10BrN3 — CID 154586869
4-bromo-5-isocyano-2,6-diphenylpyridine-3-carbonitrile (PubChem CID 154586869) has the molecular formula C19H10BrN3 and a molecular weight of 360.21 g/mol. Its IUPAC name is 4-bromo-5-isocyano-2,6-diphenylpyridine-3-carbonitrile.
| Compound Name | 4-bromo-5-isocyano-2,6-diphenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 154586869 |
| Molecular Formula | C19H10BrN3 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 4-bromo-5-isocyano-2,6-diphenylpyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(-c2ccccc2)nc(-c2ccccc2)c(C#N)c1Br |
| InChI | InChI=1S/C19H10BrN3/c1-22-19-16(20)15(12-21)17(13-8-4-2-5-9-13)23-18(19)14-10-6-3-7-11-14/h2-11H |
| InChIKey | DXJSZVTYCBVTIJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 41.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|