C66H38N6S — CID 58049693
4-[5-(3-isocyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)thiophen-2-yl]-2,7,9-triphenyl-1,10-phenanthroline-3-carbonitrile (PubChem CID 58049693) has the molecular formula C66H38N6S and a molecular weight of 947.14 g/mol. Its IUPAC name is 4-[5-(3-isocyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)thiophen-2-yl]-2,7,9-triphenyl-1,10-phenanthroline-3-carbonitrile.
| Compound Name | 4-[5-(3-isocyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)thiophen-2-yl]-2,7,9-triphenyl-1,10-phenanthroline-3-carbonitrile |
|---|---|
| PubChem CID | 58049693 |
| Molecular Formula | C66H38N6S |
| Molecular Weight | 947.14 g/mol |
| Exact Mass | 946.29 |
| IUPAC Name | 4-[5-(3-isocyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)thiophen-2-yl]-2,7,9-triphenyl-1,10-phenanthroline-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(-c2ccccc2)nc2c(ccc3c(-c4ccccc4)cc(-c4ccccc4)nc32)c1-c1ccc(-c2c(C#N)c(-c3ccccc3)nc3c2ccc2c(-c4ccccc4)cc(-c4ccccc4)nc23)s1 |
| InChI | InChI=1S/C66H38N6S/c1-68-66-59(50-35-33-48-52(42-22-10-3-11-23-42)39-55(44-26-14-5-15-27-44)70-63(48)65(50)72-61(66)46-30-18-7-19-31-46)57-37-36-56(73-57)58-49-34-32-47-51(41-20-8-2-9-21-41)38-54(43-24-12-4-13-25-43)69-62(47)64(49)71-60(53(58)40-67)45-28-16-6-17-29-45/h2-39H |
| InChIKey | VIAODUZSAHZKQR-UHFFFAOYSA-N |
| XLogP | 17.70 |
| TPSA | 79.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.14 |
| LogP ≤ 5 | 17.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|