C62H38N6S — CID 58049694
2,7,9-triphenyl-4-[5-(2,7,9-triphenylpyrido[3,2-h]quinazolin-4-yl)thiophen-2-yl]pyrido[3,2-h]quinazoline (PubChem CID 58049694) has the molecular formula C62H38N6S and a molecular weight of 899.10 g/mol. Its IUPAC name is 2,7,9-triphenyl-4-[5-(2,7,9-triphenylpyrido[3,2-h]quinazolin-4-yl)thiophen-2-yl]pyrido[3,2-h]quinazoline.
| Compound Name | 2,7,9-triphenyl-4-[5-(2,7,9-triphenylpyrido[3,2-h]quinazolin-4-yl)thiophen-2-yl]pyrido[3,2-h]quinazoline |
|---|---|
| PubChem CID | 58049694 |
| Molecular Formula | C62H38N6S |
| Molecular Weight | 899.10 g/mol |
| Exact Mass | 898.29 |
| IUPAC Name | 2,7,9-triphenyl-4-[5-(2,7,9-triphenylpyrido[3,2-h]quinazolin-4-yl)thiophen-2-yl]pyrido[3,2-h]quinazoline |
| SMILES | c1ccc(-c2cc(-c3ccccc3)c3ccc4c(-c5ccc(-c6nc(-c7ccccc7)nc7c6ccc6c(-c8ccccc8)cc(-c8ccccc8)nc67)s5)nc(-c5ccccc5)nc4c3n2)cc1 |
| InChI | InChI=1S/C62H38N6S/c1-7-19-39(20-8-1)49-37-51(41-23-11-3-12-24-41)63-57-45(49)31-33-47-55(65-61(67-59(47)57)43-27-15-5-16-28-43)53-35-36-54(69-53)56-48-34-32-46-50(40-21-9-2-10-22-40)38-52(42-25-13-4-14-26-42)64-58(46)60(48)68-62(66-56)44-29-17-6-18-30-44/h1-38H |
| InChIKey | PRCSHNRCEGHVCA-UHFFFAOYSA-N |
| XLogP | 16.07 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.10 |
| LogP ≤ 5 | 16.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|