C64H40N6 — CID 58049706
2,7,9-triphenyl-4-[3-(2,7,9-triphenylpyrido[3,2-h]quinazolin-4-yl)phenyl]pyrido[3,2-h]quinazoline (PubChem CID 58049706) has the molecular formula C64H40N6 and a molecular weight of 893.07 g/mol. Its IUPAC name is 2,7,9-triphenyl-4-[3-(2,7,9-triphenylpyrido[3,2-h]quinazolin-4-yl)phenyl]pyrido[3,2-h]quinazoline.
| Compound Name | 2,7,9-triphenyl-4-[3-(2,7,9-triphenylpyrido[3,2-h]quinazolin-4-yl)phenyl]pyrido[3,2-h]quinazoline |
|---|---|
| PubChem CID | 58049706 |
| Molecular Formula | C64H40N6 |
| Molecular Weight | 893.07 g/mol |
| Exact Mass | 892.33 |
| IUPAC Name | 2,7,9-triphenyl-4-[3-(2,7,9-triphenylpyrido[3,2-h]quinazolin-4-yl)phenyl]pyrido[3,2-h]quinazoline |
| SMILES | c1ccc(-c2cc(-c3ccccc3)c3ccc4c(-c5cccc(-c6nc(-c7ccccc7)nc7c6ccc6c(-c8ccccc8)cc(-c8ccccc8)nc67)c5)nc(-c5ccccc5)nc4c3n2)cc1 |
| InChI | InChI=1S/C64H40N6/c1-7-20-41(21-8-1)53-39-55(43-24-11-3-12-25-43)65-59-49(53)34-36-51-57(67-63(69-61(51)59)45-28-15-5-16-29-45)47-32-19-33-48(38-47)58-52-37-35-50-54(42-22-9-2-10-23-42)40-56(44-26-13-4-14-27-44)66-60(50)62(52)70-64(68-58)46-30-17-6-18-31-46/h1-40H |
| InChIKey | PNKUWEQJEBIUNT-UHFFFAOYSA-N |
| XLogP | 16.01 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.07 |
| LogP ≤ 5 | 16.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|