C65H41N7 — CID 58049712
4-[5-(3-isocyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)-1-methylpyrrol-2-yl]-2,7,9-triphenylpyrido[3,2-h]quinazoline (PubChem CID 58049712) has the molecular formula C65H41N7 and a molecular weight of 920.09 g/mol. Its IUPAC name is 4-[5-(3-isocyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)-1-methylpyrrol-2-yl]-2,7,9-triphenylpyrido[3,2-h]quinazoline.
| Compound Name | 4-[5-(3-isocyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)-1-methylpyrrol-2-yl]-2,7,9-triphenylpyrido[3,2-h]quinazoline |
|---|---|
| PubChem CID | 58049712 |
| Molecular Formula | C65H41N7 |
| Molecular Weight | 920.09 g/mol |
| Exact Mass | 919.34 |
| IUPAC Name | 4-[5-(3-isocyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)-1-methylpyrrol-2-yl]-2,7,9-triphenylpyrido[3,2-h]quinazoline |
| SMILES | [C-]#[N+]c1c(-c2ccccc2)nc2c(ccc3c(-c4ccccc4)cc(-c4ccccc4)nc32)c1-c1ccc(-c2nc(-c3ccccc3)nc3c2ccc2c(-c4ccccc4)cc(-c4ccccc4)nc23)n1C |
| InChI | InChI=1S/C65H41N7/c1-66-64-57(49-35-33-47-51(41-21-9-3-10-22-41)39-53(43-25-13-5-14-26-43)67-60(47)62(49)69-58(64)45-29-17-7-18-30-45)55-37-38-56(72(55)2)59-50-36-34-48-52(42-23-11-4-12-24-42)40-54(44-27-15-6-16-28-44)68-61(48)63(50)71-65(70-59)46-31-19-8-20-32-46/h3-40H,2H3 |
| InChIKey | XDGORNUPEIWEDT-UHFFFAOYSA-N |
| XLogP | 16.50 |
| TPSA | 73.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.09 |
| LogP ≤ 5 | 16.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|