C72H42N8 — CID 88554057
4-[5-[6-(3-cyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)-3-pyridinyl]-2-pyridinyl]-2,7,9-triphenyl-1,10-phenanthroline-3-carbonitrile (PubChem CID 88554057) has the molecular formula C72H42N8 and a molecular weight of 1019.18 g/mol. Its IUPAC name is 4-[5-[6-(3-cyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)-3-pyridinyl]-2-pyridinyl]-2,7,9-triphenyl-1,10-phenanthroline-3-carbonitrile.
| Compound Name | 4-[5-[6-(3-cyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)-3-pyridinyl]-2-pyridinyl]-2,7,9-triphenyl-1,10-phenanthroline-3-carbonitrile |
|---|---|
| PubChem CID | 88554057 |
| Molecular Formula | C72H42N8 |
| Molecular Weight | 1019.18 g/mol |
| Exact Mass | 1018.35 |
| IUPAC Name | 4-[5-[6-(3-cyano-2,7,9-triphenyl-1,10-phenanthrolin-4-yl)-3-pyridinyl]-2-pyridinyl]-2,7,9-triphenyl-1,10-phenanthroline-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc2c(ccc3c(-c4ccccc4)cc(-c4ccccc4)nc32)c1-c1ccc(-c2ccc(-c3c(C#N)c(-c4ccccc4)nc4c3ccc3c(-c5ccccc5)cc(-c5ccccc5)nc34)nc2)cn1 |
| InChI | InChI=1S/C72H42N8/c73-41-59-65(55-35-33-53-57(45-19-7-1-8-20-45)39-63(47-23-11-3-12-24-47)77-69(53)71(55)79-67(59)49-27-15-5-16-28-49)61-37-31-51(43-75-61)52-32-38-62(76-44-52)66-56-36-34-54-58(46-21-9-2-10-22-46)40-64(48-25-13-4-14-26-48)78-70(54)72(56)80-68(60(66)42-74)50-29-17-6-18-30-50/h1-40,43-44H |
| InChIKey | DYQHIWZFLKMGSE-UHFFFAOYSA-N |
| XLogP | 17.42 |
| TPSA | 124.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.18 |
| LogP ≤ 5 | 17.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|