C11H6KN3OS — CID 136859361
potassium 5-cyano-4-phenyl-2-sulfanylidene-1H-pyrimidin-6-olate (PubChem CID 136859361) has the molecular formula C11H6KN3OS and a molecular weight of 267.35 g/mol. Its IUPAC name is potassium 5-cyano-4-phenyl-2-sulfanylidene-1H-pyrimidin-6-olate.
| Compound Name | potassium 5-cyano-4-phenyl-2-sulfanylidene-1H-pyrimidin-6-olate |
|---|---|
| PubChem CID | 136859361 |
| Molecular Formula | C11H6KN3OS |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | potassium 5-cyano-4-phenyl-2-sulfanylidene-1H-pyrimidin-6-olate |
| SMILES | N#Cc1c(-c2ccccc2)nc(=S)[nH]c1[O-].[K+] |
| InChI | InChI=1S/C11H7N3OS.K/c12-6-8-9(7-4-2-1-3-5-7)13-11(16)14-10(8)15;/h1-5H,(H2,13,14,15,16);/q;+1/p-1 |
| InChIKey | TZHVHEAKNPHXBG-UHFFFAOYSA-M |
| XLogP | -1.24 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|