C12H6Cl2N2 — CID 123187056
4,6-dichloro-3-isocyano-2-phenylpyridine (PubChem CID 123187056) has the molecular formula C12H6Cl2N2 and a molecular weight of 249.10 g/mol. Its IUPAC name is 4,6-dichloro-3-isocyano-2-phenylpyridine.
| Compound Name | 4,6-dichloro-3-isocyano-2-phenylpyridine |
|---|---|
| PubChem CID | 123187056 |
| Molecular Formula | C12H6Cl2N2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 4,6-dichloro-3-isocyano-2-phenylpyridine |
| SMILES | [C-]#[N+]c1c(Cl)cc(Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C12H6Cl2N2/c1-15-12-9(13)7-10(14)16-11(12)8-5-3-2-4-6-8/h2-7H |
| InChIKey | RCFTXIOHRYWHLE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|