C28H19ClN2 — CID 118641046
4-chloro-6-(3,5-diphenylphenyl)-2-phenylpyrimidine (PubChem CID 118641046) has the molecular formula C28H19ClN2 and a molecular weight of 418.93 g/mol. Its IUPAC name is 4-chloro-6-(3,5-diphenylphenyl)-2-phenylpyrimidine.
| Compound Name | 4-chloro-6-(3,5-diphenylphenyl)-2-phenylpyrimidine |
|---|---|
| PubChem CID | 118641046 |
| Molecular Formula | C28H19ClN2 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 4-chloro-6-(3,5-diphenylphenyl)-2-phenylpyrimidine |
| SMILES | Clc1cc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C28H19ClN2/c29-27-19-26(30-28(31-27)22-14-8-3-9-15-22)25-17-23(20-10-4-1-5-11-20)16-24(18-25)21-12-6-2-7-13-21/h1-19H |
| InChIKey | TZDRPWPXWCOAEK-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |