C44H32BCl3N4O2 — CID 163457362
4-chloro-2-phenyl-6-(3-phenylphenyl)pyrimidine;4,6-dichloro-2-phenylpyrimidine;(3-phenylphenyl)boronic acid (PubChem CID 163457362) has the molecular formula C44H32BCl3N4O2 and a molecular weight of 765.94 g/mol. Its IUPAC name is 4-chloro-2-phenyl-6-(3-phenylphenyl)pyrimidine;4,6-dichloro-2-phenylpyrimidine;(3-phenylphenyl)boronic acid.
| Compound Name | 4-chloro-2-phenyl-6-(3-phenylphenyl)pyrimidine;4,6-dichloro-2-phenylpyrimidine;(3-phenylphenyl)boronic acid |
|---|---|
| PubChem CID | 163457362 |
| Molecular Formula | C44H32BCl3N4O2 |
| Molecular Weight | 765.94 g/mol |
| Exact Mass | 764.17 |
| IUPAC Name | 4-chloro-2-phenyl-6-(3-phenylphenyl)pyrimidine;4,6-dichloro-2-phenylpyrimidine;(3-phenylphenyl)boronic acid |
| SMILES | Clc1cc(-c2cccc(-c3ccccc3)c2)nc(-c2ccccc2)n1.Clc1cc(Cl)nc(-c2ccccc2)n1.OB(O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H15ClN2.C12H11BO2.C10H6Cl2N2/c23-21-15-20(24-22(25-21)17-10-5-2-6-11-17)19-13-7-12-18(14-19)16-8-3-1-4-9-16;14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10;11-8-6-9(12)14-10(13-8)7-4-2-1-3-5-7/h1-15H;1-9,14-15H;1-6H |
| InChIKey | BLPJASDPRDHQDQ-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.94 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|