C14H9N5 — CID 23399500
6-isocyano-5-methyl-2-phenyl-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carbonitrile (PubChem CID 23399500) has the molecular formula C14H9N5 and a molecular weight of 247.26 g/mol. Its IUPAC name is 6-isocyano-5-methyl-2-phenyl-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carbonitrile.
| Compound Name | 6-isocyano-5-methyl-2-phenyl-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carbonitrile |
|---|---|
| PubChem CID | 23399500 |
| Molecular Formula | C14H9N5 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 6-isocyano-5-methyl-2-phenyl-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carbonitrile |
| SMILES | [C-]#[N+]c1c(C#N)c2nc(-c3ccccc3)[nH]n2c1C |
| InChI | InChI=1S/C14H9N5/c1-9-12(16-2)11(8-15)14-17-13(18-19(9)14)10-6-4-3-5-7-10/h3-7H,1H3,(H,17,18) |
| InChIKey | FARMLEPYUSKRAN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|