C29H16N4 — CID 155636339
4-indol-1-yl-5-isocyano-2,6-diphenylbenzene-1,3-dicarbonitrile (PubChem CID 155636339) has the molecular formula C29H16N4 and a molecular weight of 420.48 g/mol. Its IUPAC name is 4-indol-1-yl-5-isocyano-2,6-diphenylbenzene-1,3-dicarbonitrile.
| Compound Name | 4-indol-1-yl-5-isocyano-2,6-diphenylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 155636339 |
| Molecular Formula | C29H16N4 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 4-indol-1-yl-5-isocyano-2,6-diphenylbenzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1c(-c2ccccc2)c(C#N)c(-c2ccccc2)c(C#N)c1-n1ccc2ccccc21 |
| InChI | InChI=1S/C29H16N4/c1-32-28-27(22-13-6-3-7-14-22)23(18-30)26(21-11-4-2-5-12-21)24(19-31)29(28)33-17-16-20-10-8-9-15-25(20)33/h2-17H |
| InChIKey | HFPJKCMIVSQLHL-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 56.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|