C51H32N6 — CID 130352833
2-[4-(6,7-dihydroindol-1-yl)phenyl]-4,6-bis(4-indol-1-ylphenyl)benzene-1,3,5-tricarbonitrile (PubChem CID 130352833) has the molecular formula C51H32N6 and a molecular weight of 728.86 g/mol. Its IUPAC name is 2-[4-(6,7-dihydroindol-1-yl)phenyl]-4,6-bis(4-indol-1-ylphenyl)benzene-1,3,5-tricarbonitrile.
| Compound Name | 2-[4-(6,7-dihydroindol-1-yl)phenyl]-4,6-bis(4-indol-1-ylphenyl)benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 130352833 |
| Molecular Formula | C51H32N6 |
| Molecular Weight | 728.86 g/mol |
| Exact Mass | 728.27 |
| IUPAC Name | 2-[4-(6,7-dihydroindol-1-yl)phenyl]-4,6-bis(4-indol-1-ylphenyl)benzene-1,3,5-tricarbonitrile |
| SMILES | N#Cc1c(-c2ccc(-n3ccc4c3CCC=C4)cc2)c(C#N)c(-c2ccc(-n3ccc4ccccc43)cc2)c(C#N)c1-c1ccc(-n2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C51H32N6/c52-31-43-49(37-13-19-40(20-14-37)55-28-25-34-7-1-4-10-46(34)55)44(32-53)51(39-17-23-42(24-18-39)57-30-27-36-9-3-6-12-48(36)57)45(33-54)50(43)38-15-21-41(22-16-38)56-29-26-35-8-2-5-11-47(35)56/h1-5,7-11,13-30H,6,12H2 |
| InChIKey | GJRVSYFGOSIFDU-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 86.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.86 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |