C24H20N4 — CID 144936362
4-indol-1-ylaniline;naphthalene-1,2-diimine (PubChem CID 144936362) has the molecular formula C24H20N4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-indol-1-ylaniline;naphthalene-1,2-diimine.
| Compound Name | 4-indol-1-ylaniline;naphthalene-1,2-diimine |
|---|---|
| PubChem CID | 144936362 |
| Molecular Formula | C24H20N4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 4-indol-1-ylaniline;naphthalene-1,2-diimine |
| SMILES | Nc1ccc(-n2ccc3ccccc32)cc1.[H]/N=C1C(=N\[H])\C=Cc2ccccc2\1 |
| InChI | InChI=1S/C14H12N2.C10H8N2/c15-12-5-7-13(8-6-12)16-10-9-11-3-1-2-4-14(11)16;11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-10H,15H2;1-6,11-12H/b;11-9+,12-10- |
| InChIKey | PWAVBGNTFWLIDI-YAKWFZIYSA-N |
| XLogP | 5.31 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|