C30H25N5 — CID 144936370
aniline;4-(10-phenylphenazin-5-yl)cyclohexa-3,5-diene-1,2-diimine (PubChem CID 144936370) has the molecular formula C30H25N5 and a molecular weight of 455.57 g/mol. Its IUPAC name is aniline;4-(10-phenylphenazin-5-yl)cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | aniline;4-(10-phenylphenazin-5-yl)cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 144936370 |
| Molecular Formula | C30H25N5 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | aniline;4-(10-phenylphenazin-5-yl)cyclohexa-3,5-diene-1,2-diimine |
| SMILES | Nc1ccccc1.[H]/N=C1/C=C(N2c3ccccc3N(c3ccccc3)c3ccccc32)C=C/C1=N\[H] |
| InChI | InChI=1S/C24H18N4.C6H7N/c25-19-15-14-18(16-20(19)26)28-23-12-6-4-10-21(23)27(17-8-2-1-3-9-17)22-11-5-7-13-24(22)28;7-6-4-2-1-3-5-6/h1-16,25-26H;1-5H,7H2/b25-19+,26-20-; |
| InChIKey | WVOZFTVISRZTKD-UVLXCCNKSA-N |
| XLogP | 7.37 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|