C10H9N3 — CID 146710900
1-phenylpyrrole-2,5-diimine (PubChem CID 146710900) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-phenylpyrrole-2,5-diimine.
| Compound Name | 1-phenylpyrrole-2,5-diimine |
|---|---|
| PubChem CID | 146710900 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 1-phenylpyrrole-2,5-diimine |
| SMILES | [H]/N=C1\C=C/C(=N\[H])N1c1ccccc1 |
| InChI | InChI=1S/C10H9N3/c11-9-6-7-10(12)13(9)8-4-2-1-3-5-8/h1-7,11-12H/b11-9+,12-10+ |
| InChIKey | RBLOBYZOHZQBQD-WGDLNXRISA-N |
| XLogP | 2.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|