C16H14N2 — CID 154931756
(3Z)-3-ethylidene-1-phenylindol-2-imine (PubChem CID 154931756) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (3Z)-3-ethylidene-1-phenylindol-2-imine.
| Compound Name | (3Z)-3-ethylidene-1-phenylindol-2-imine |
|---|---|
| PubChem CID | 154931756 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (3Z)-3-ethylidene-1-phenylindol-2-imine |
| SMILES | [H]/N=C1C(=C/C)\c2ccccc2N\1c1ccccc1 |
| InChI | InChI=1S/C16H14N2/c1-2-13-14-10-6-7-11-15(14)18(16(13)17)12-8-4-3-5-9-12/h2-11,17H,1H3/b13-2-,17-16+ |
| InChIKey | JJRYGQQYTXXLQO-KVFKYMJISA-N |
| XLogP | 4.22 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|