C25H22N2 — CID 142288460
2-ethenyl-1,4-diphenyl-3-[(Z)-prop-1-enyl]quinoxaline (PubChem CID 142288460) has the molecular formula C25H22N2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-ethenyl-1,4-diphenyl-3-[(Z)-prop-1-enyl]quinoxaline.
| Compound Name | 2-ethenyl-1,4-diphenyl-3-[(Z)-prop-1-enyl]quinoxaline |
|---|---|
| PubChem CID | 142288460 |
| Molecular Formula | C25H22N2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-ethenyl-1,4-diphenyl-3-[(Z)-prop-1-enyl]quinoxaline |
| SMILES | C=CC1=C(/C=C\C)N(c2ccccc2)c2ccccc2N1c1ccccc1 |
| InChI | InChI=1S/C25H22N2/c1-3-13-23-22(4-2)26(20-14-7-5-8-15-20)24-18-11-12-19-25(24)27(23)21-16-9-6-10-17-21/h3-19H,2H2,1H3/b13-3- |
| InChIKey | HYRLPEUADGWJTG-DXNYSGJVSA-N |
| XLogP | 6.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |