C51H60N4 — CID 155705240
1-tert-butyl-4-[4-[2-[4-(3,5-ditert-butylphenyl)-2,3-bis(ethenyl)quinoxalin-1-yl]propan-2-yl]phenyl]-2,3-bis(ethenyl)quinoxaline (PubChem CID 155705240) has the molecular formula C51H60N4 and a molecular weight of 729.07 g/mol. Its IUPAC name is 1-tert-butyl-4-[4-[2-[4-(3,5-ditert-butylphenyl)-2,3-bis(ethenyl)quinoxalin-1-yl]propan-2-yl]phenyl]-2,3-bis(ethenyl)quinoxaline.
| Compound Name | 1-tert-butyl-4-[4-[2-[4-(3,5-ditert-butylphenyl)-2,3-bis(ethenyl)quinoxalin-1-yl]propan-2-yl]phenyl]-2,3-bis(ethenyl)quinoxaline |
|---|---|
| PubChem CID | 155705240 |
| Molecular Formula | C51H60N4 |
| Molecular Weight | 729.07 g/mol |
| Exact Mass | 728.48 |
| IUPAC Name | 1-tert-butyl-4-[4-[2-[4-(3,5-ditert-butylphenyl)-2,3-bis(ethenyl)quinoxalin-1-yl]propan-2-yl]phenyl]-2,3-bis(ethenyl)quinoxaline |
| SMILES | C=CC1=C(C=C)N(C(C)(C)C)c2ccccc2N1c1ccc(C(C)(C)N2C(C=C)=C(C=C)N(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C51H60N4/c1-16-40-42(18-3)54(50(11,12)13)46-26-22-20-24-44(46)52(40)38-30-28-35(29-31-38)51(14,15)55-43(19-4)41(17-2)53(45-25-21-23-27-47(45)55)39-33-36(48(5,6)7)32-37(34-39)49(8,9)10/h16-34H,1-4H2,5-15H3 |
| InChIKey | BTINMFPZJFDHQG-UHFFFAOYSA-N |
| XLogP | 14.10 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.07 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |