C37H34N2 — CID 168782836
5-(4-tert-butylphenyl)-10-(9,9-dimethylfluoren-2-yl)phenazine (PubChem CID 168782836) has the molecular formula C37H34N2 and a molecular weight of 506.69 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-10-(9,9-dimethylfluoren-2-yl)phenazine.
| Compound Name | 5-(4-tert-butylphenyl)-10-(9,9-dimethylfluoren-2-yl)phenazine |
|---|---|
| PubChem CID | 168782836 |
| Molecular Formula | C37H34N2 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 5-(4-tert-butylphenyl)-10-(9,9-dimethylfluoren-2-yl)phenazine |
| SMILES | CC(C)(C)c1ccc(N2c3ccccc3N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccccc32)cc1 |
| InChI | InChI=1S/C37H34N2/c1-36(2,3)25-18-20-26(21-19-25)38-32-14-8-10-16-34(32)39(35-17-11-9-15-33(35)38)27-22-23-29-28-12-6-7-13-30(28)37(4,5)31(29)24-27/h6-24H,1-5H3 |
| InChIKey | ALMNGZBNQISJFA-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |