C51H53GeN — CID 166025201
9,9-dimethyl-10-(3,7,7'-tritert-butyl-5,5'-spirobi[benzo[b][1]benzogermole]-3'-yl)acridine (PubChem CID 166025201) has the molecular formula C51H53GeN and a molecular weight of 752.60 g/mol. Its IUPAC name is 9,9-dimethyl-10-(3,7,7'-tritert-butyl-5,5'-spirobi[benzo[b][1]benzogermole]-3'-yl)acridine.
| Compound Name | 9,9-dimethyl-10-(3,7,7'-tritert-butyl-5,5'-spirobi[benzo[b][1]benzogermole]-3'-yl)acridine |
|---|---|
| PubChem CID | 166025201 |
| Molecular Formula | C51H53GeN |
| Molecular Weight | 752.60 g/mol |
| Exact Mass | 753.34 |
| IUPAC Name | 9,9-dimethyl-10-(3,7,7'-tritert-butyl-5,5'-spirobi[benzo[b][1]benzogermole]-3'-yl)acridine |
| SMILES | CC(C)(C)c1ccc2c(c1)[Ge]1(c3cc(N4c5ccccc5C(C)(C)c5ccccc54)ccc3-2)c2cc(C(C)(C)C)ccc2-c2ccc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C51H53GeN/c1-48(2,3)32-20-24-36-37-25-21-33(49(4,5)6)29-43(37)52(42(36)28-32)44-30-34(50(7,8)9)22-26-38(44)39-27-23-35(31-45(39)52)53-46-18-14-12-16-40(46)51(10,11)41-17-13-15-19-47(41)53/h12-31H,1-11H3 |
| InChIKey | NLYJVYMNZWUTNJ-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.60 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |