C29H35N — CID 135248210
2,7-ditert-butyl-9,9-dimethyl-10-phenylacridine (PubChem CID 135248210) has the molecular formula C29H35N and a molecular weight of 397.61 g/mol. Its IUPAC name is 2,7-ditert-butyl-9,9-dimethyl-10-phenylacridine.
| Compound Name | 2,7-ditert-butyl-9,9-dimethyl-10-phenylacridine |
|---|---|
| PubChem CID | 135248210 |
| Molecular Formula | C29H35N |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | 2,7-ditert-butyl-9,9-dimethyl-10-phenylacridine |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(C)c1cc(C(C)(C)C)ccc1N2c1ccccc1 |
| InChI | InChI=1S/C29H35N/c1-27(2,3)20-14-16-25-23(18-20)29(7,8)24-19-21(28(4,5)6)15-17-26(24)30(25)22-12-10-9-11-13-22/h9-19H,1-8H3 |
| InChIKey | RXXLIXJPBPSXMZ-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |