About 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine
2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine (PubChem CID 145125517) has the molecular formula C18H15NO
and a molecular weight of 261.32 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine.
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine |
| PubChem CID | 145125517 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine |
| SMILES | C=CC1=C(C=C)N(c2ccccc2)c2ccccc2O1 |
| InChI | InChI=1S/C18H15NO/c1-3-15-17(4-2)20-18-13-9-8-12-16(18)19(15)14-10-6-5-7-11-14/h3-13H,1-2H2 |
| InChIKey | HXKUNOBYRWTXLB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine?
The IUPAC name of 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine (CID 145125517) is 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine.
What is the SMILES notation for 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine?
The canonical SMILES for 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine is C=CC1=C(C=C)N(c2ccccc2)c2ccccc2O1.
What is the InChIKey of 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine?
The InChIKey is HXKUNOBYRWTXLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO/c1-3-15-17(4-2)20-18-13-9-8-12-16(18)19(15)14-10-6-5-7-11-14/h3-13H,1-2H2.
What are the key properties of 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine?
2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine has a molecular weight of 261.32 g/mol, XLogP of 4.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine is sourced from PubChem (CID 145125517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).