C13H15NO — CID 143087076
3-ethenyl-2-ethyl-4-methyl-1,4-benzoxazine (PubChem CID 143087076) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-ethenyl-2-ethyl-4-methyl-1,4-benzoxazine.
| Compound Name | 3-ethenyl-2-ethyl-4-methyl-1,4-benzoxazine |
|---|---|
| PubChem CID | 143087076 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 3-ethenyl-2-ethyl-4-methyl-1,4-benzoxazine |
| SMILES | C=CC1=C(CC)Oc2ccccc2N1C |
| InChI | InChI=1S/C13H15NO/c1-4-10-12(5-2)15-13-9-7-6-8-11(13)14(10)3/h4,6-9H,1,5H2,2-3H3 |
| InChIKey | YDOCPMAPFSAJEV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |