About 2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine
2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine (PubChem CID 142248238) has the molecular formula C14H16AsN
and a molecular weight of 273.21 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine.
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine |
| PubChem CID | 142248238 |
| Molecular Formula | C14H16AsN |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine |
| SMILES | C=CC1=C(C=C)[As](C)c2ccccc2N1C |
| InChI | InChI=1S/C14H16AsN/c1-5-11-13(6-2)16(4)14-10-8-7-9-12(14)15(11)3/h5-10H,1-2H2,3-4H3 |
| InChIKey | YRGZFDKGJGSQPI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine?
The IUPAC name of 2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine (CID 142248238) is 2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine.
What is the SMILES notation for 2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine?
The canonical SMILES for 2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine is C=CC1=C(C=C)[As](C)c2ccccc2N1C.
What is the InChIKey of 2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine?
The InChIKey is YRGZFDKGJGSQPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16AsN/c1-5-11-13(6-2)16(4)14-10-8-7-9-12(14)15(11)3/h5-10H,1-2H2,3-4H3.
What are the key properties of 2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine?
2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine has a molecular weight of 273.21 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)-1,4-dimethyl-1,4-benzazarsinine is sourced from PubChem (CID 142248238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).