C18H23N — CID 142201727
2,3-bis(ethenyl)-1-ethyl-1-benzazepine;ethane (PubChem CID 142201727) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1-ethyl-1-benzazepine;ethane.
| Compound Name | 2,3-bis(ethenyl)-1-ethyl-1-benzazepine;ethane |
|---|---|
| PubChem CID | 142201727 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2,3-bis(ethenyl)-1-ethyl-1-benzazepine;ethane |
| SMILES | C=CC1=C(C=C)N(CC)c2ccccc2C=C1.CC |
| InChI | InChI=1S/C16H17N.C2H6/c1-4-13-11-12-14-9-7-8-10-16(14)17(6-3)15(13)5-2;1-2/h4-5,7-12H,1-2,6H2,3H3;1-2H3 |
| InChIKey | RNNFIAJZMVGSGC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |