C25H36N2 — CID 154676703
(3Z,5Z)-N-(2,5-dimethylhexyl)-3,4-bis(ethenyl)-2H-1-benzazocin-1-amine;ethene (PubChem CID 154676703) has the molecular formula C25H36N2 and a molecular weight of 364.58 g/mol. Its IUPAC name is (3Z,5Z)-N-(2,5-dimethylhexyl)-3,4-bis(ethenyl)-2H-1-benzazocin-1-amine;ethene.
| Compound Name | (3Z,5Z)-N-(2,5-dimethylhexyl)-3,4-bis(ethenyl)-2H-1-benzazocin-1-amine;ethene |
|---|---|
| PubChem CID | 154676703 |
| Molecular Formula | C25H36N2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.29 |
| IUPAC Name | (3Z,5Z)-N-(2,5-dimethylhexyl)-3,4-bis(ethenyl)-2H-1-benzazocin-1-amine;ethene |
| SMILES | C=C.C=CC1=C(\C=C)CN(NCC(C)CCC(C)C)c2ccccc2/C=C\1 |
| InChI | InChI=1S/C23H32N2.C2H4/c1-6-20-14-15-22-10-8-9-11-23(22)25(17-21(20)7-2)24-16-19(5)13-12-18(3)4;1-2/h6-11,14-15,18-19,24H,1-2,12-13,16-17H2,3-5H3;1-2H2/b15-14-,21-20-; |
| InChIKey | RHFXAEHOZOHTJC-GEKGYPSASA-N |
| XLogP | 6.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|