C25H38 — CID 144723540
2,5-dimethylhexylbenzene;prop-1-ene;1,4-xylene (PubChem CID 144723540) has the molecular formula C25H38 and a molecular weight of 338.58 g/mol. Its IUPAC name is 2,5-dimethylhexylbenzene;prop-1-ene;1,4-xylene.
| Compound Name | 2,5-dimethylhexylbenzene;prop-1-ene;1,4-xylene |
|---|---|
| PubChem CID | 144723540 |
| Molecular Formula | C25H38 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | 2,5-dimethylhexylbenzene;prop-1-ene;1,4-xylene |
| SMILES | C=CC.CC(C)CCC(C)Cc1ccccc1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C14H22.C8H10.C3H6/c1-12(2)9-10-13(3)11-14-7-5-4-6-8-14;1-7-3-5-8(2)6-4-7;1-3-2/h4-8,12-13H,9-11H2,1-3H3;3-6H,1-2H3;3H,1H2,2H3 |
| InChIKey | FKUVESXLEPUJCU-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|