C17H28 — CID 3085733
[(2R,5R)-5-ethyl-2-methyloctyl]benzene (PubChem CID 3085733) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is [(2R,5R)-5-ethyl-2-methyloctyl]benzene.
| Compound Name | [(2R,5R)-5-ethyl-2-methyloctyl]benzene |
|---|---|
| PubChem CID | 3085733 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | [(2R,5R)-5-ethyl-2-methyloctyl]benzene |
| SMILES | CCCC(CC)CC[C@@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C17H28/c1-4-9-16(5-2)13-12-15(3)14-17-10-7-6-8-11-17/h6-8,10-11,15-16H,4-5,9,12-14H2,1-3H3/t15-,16?/m1/s1 |
| InChIKey | AFCQSOSAIBQVOU-AAFJCEBUSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |