About pentan-2-ylbenzene;2-propylpentylbenzene
pentan-2-ylbenzene;2-propylpentylbenzene (PubChem CID 142193599) has the molecular formula C25H38
and a molecular weight of 338.58 g/mol. Its IUPAC name is pentan-2-ylbenzene;2-propylpentylbenzene.
Molecular Properties
| Compound Name | pentan-2-ylbenzene;2-propylpentylbenzene |
| PubChem CID | 142193599 |
| Molecular Formula | C25H38 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | pentan-2-ylbenzene;2-propylpentylbenzene |
| SMILES | CCCC(C)c1ccccc1.CCCC(CCC)Cc1ccccc1 |
| InChI | InChI=1S/C14H22.C11H16/c1-3-8-13(9-4-2)12-14-10-6-5-7-11-14;1-3-7-10(2)11-8-5-4-6-9-11/h5-7,10-11,13H,3-4,8-9,12H2,1-2H3;4-6,8-10H,3,7H2,1-2H3 |
| InChIKey | MMIXSGQLXQEJER-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze pentan-2-ylbenzene;2-propylpentylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-ylbenzene;2-propylpentylbenzene?
The IUPAC name of pentan-2-ylbenzene;2-propylpentylbenzene (CID 142193599) is pentan-2-ylbenzene;2-propylpentylbenzene.
What is the SMILES notation for pentan-2-ylbenzene;2-propylpentylbenzene?
The canonical SMILES for pentan-2-ylbenzene;2-propylpentylbenzene is CCCC(C)c1ccccc1.CCCC(CCC)Cc1ccccc1.
What is the InChIKey of pentan-2-ylbenzene;2-propylpentylbenzene?
The InChIKey is MMIXSGQLXQEJER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22.C11H16/c1-3-8-13(9-4-2)12-14-10-6-5-7-11-14;1-3-7-10(2)11-8-5-4-6-9-11/h5-7,10-11,13H,3-4,8-9,12H2,1-2H3;4-6,8-10H,3,7H2,1-2H3.
What are the key properties of pentan-2-ylbenzene;2-propylpentylbenzene?
pentan-2-ylbenzene;2-propylpentylbenzene has a molecular weight of 338.58 g/mol, XLogP of 8.04, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-ylbenzene;2-propylpentylbenzene is sourced from PubChem (CID 142193599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).