About 2-ethylbutylbenzene;methane
2-ethylbutylbenzene;methane (PubChem CID 158777195) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is 2-ethylbutylbenzene;methane.
Molecular Properties
| Compound Name | 2-ethylbutylbenzene;methane |
| PubChem CID | 158777195 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 2-ethylbutylbenzene;methane |
| SMILES | C.CCC(CC)Cc1ccccc1 |
| InChI | InChI=1S/C12H18.CH4/c1-3-11(4-2)10-12-8-6-5-7-9-12;/h5-9,11H,3-4,10H2,1-2H3;1H4 |
| InChIKey | IQPOBJKBTOLEBW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-ethylbutylbenzene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbutylbenzene;methane?
The IUPAC name of 2-ethylbutylbenzene;methane (CID 158777195) is 2-ethylbutylbenzene;methane.
What is the SMILES notation for 2-ethylbutylbenzene;methane?
The canonical SMILES for 2-ethylbutylbenzene;methane is C.CCC(CC)Cc1ccccc1.
What is the InChIKey of 2-ethylbutylbenzene;methane?
The InChIKey is IQPOBJKBTOLEBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.CH4/c1-3-11(4-2)10-12-8-6-5-7-9-12;/h5-9,11H,3-4,10H2,1-2H3;1H4.
What are the key properties of 2-ethylbutylbenzene;methane?
2-ethylbutylbenzene;methane has a molecular weight of 178.32 g/mol, XLogP of 4.30, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbutylbenzene;methane is sourced from PubChem (CID 158777195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).