C15H24O2 — CID 141380082
4-benzyl-2-ethylhexane-1,6-diol (PubChem CID 141380082) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 4-benzyl-2-ethylhexane-1,6-diol.
| Compound Name | 4-benzyl-2-ethylhexane-1,6-diol |
|---|---|
| PubChem CID | 141380082 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 4-benzyl-2-ethylhexane-1,6-diol |
| SMILES | CCC(CO)CC(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C15H24O2/c1-2-13(12-17)10-15(8-9-16)11-14-6-4-3-5-7-14/h3-7,13,15-17H,2,8-12H2,1H3 |
| InChIKey | CQGPOGSFEGQUNG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |