About 3-benzylpentanoic acid
3-benzylpentanoic acid (PubChem CID 57185920) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-benzylpentanoic acid.
Molecular Properties
| Compound Name | 3-benzylpentanoic acid |
| PubChem CID | 57185920 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 3-benzylpentanoic acid |
| SMILES | CCC(CC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C12H16O2/c1-2-10(9-12(13)14)8-11-6-4-3-5-7-11/h3-7,10H,2,8-9H2,1H3,(H,13,14) |
| InChIKey | IUPRIAQWPHFJRZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-benzylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylpentanoic acid?
The IUPAC name of 3-benzylpentanoic acid (CID 57185920) is 3-benzylpentanoic acid.
What is the SMILES notation for 3-benzylpentanoic acid?
The canonical SMILES for 3-benzylpentanoic acid is CCC(CC(=O)O)Cc1ccccc1.
What is the InChIKey of 3-benzylpentanoic acid?
The InChIKey is IUPRIAQWPHFJRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-2-10(9-12(13)14)8-11-6-4-3-5-7-11/h3-7,10H,2,8-9H2,1H3,(H,13,14).
What are the key properties of 3-benzylpentanoic acid?
3-benzylpentanoic acid has a molecular weight of 192.26 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylpentanoic acid is sourced from PubChem (CID 57185920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).